Refactor pre-Doxy siphon scripts; VPP-396 61/2861/6
authorChris Luke <chrisy@flirble.org>
Mon, 12 Sep 2016 12:55:13 +0000 (08:55 -0400)
committerChris Luke <chrisy@flirble.org>
Wed, 21 Sep 2016 19:42:25 +0000 (15:42 -0400)
- Modularize the code to make the Siphon process easier to
  maintain.
- Move much of the output rendering into Jinja2 templates.
- Add syscfg siphon type for startup config documentation.
- Add sample syscfg documentation.
- Add clicfg and syscfg preamble docs, adapted from their wiki pages.
- Fix sorting of CLI items across multiple directories.

Change-Id: Ib8288fe005adfea68ceed75a38ff8eba25d3cc79
Signed-off-by: Chris Luke <chrisy@flirble.org>
28 files changed:
doxygen/Makefile
doxygen/dir.dox.sample
doxygen/doxygen.cfg
doxygen/siphon-generate [new file with mode: 0755]
doxygen/siphon-process [new file with mode: 0755]
doxygen/siphon/__init__.py [new file with mode: 0644]
doxygen/siphon/generate.py [new file with mode: 0644]
doxygen/siphon/generate_clicmd.py [new file with mode: 0644]
doxygen/siphon/generate_syscfg.py [new file with mode: 0644]
doxygen/siphon/parsers.py [new file with mode: 0644]
doxygen/siphon/process.py [new file with mode: 0644]
doxygen/siphon/process_clicmd.py [new file with mode: 0644]
doxygen/siphon/process_syscfg.py [new file with mode: 0644]
doxygen/siphon_generate.py [deleted file]
doxygen/siphon_process.py [deleted file]
doxygen/siphon_templates/clicmd/index_entry.md [new file with mode: 0644]
doxygen/siphon_templates/clicmd/index_header.md [new file with mode: 0644]
doxygen/siphon_templates/clicmd/item_format.md [new file with mode: 0644]
doxygen/siphon_templates/default/index_entry.md [new file with mode: 0644]
doxygen/siphon_templates/default/index_section.md [new file with mode: 0644]
doxygen/siphon_templates/default/item_format.md [new file with mode: 0644]
doxygen/siphon_templates/default/item_header.md [new file with mode: 0644]
doxygen/siphon_templates/syscfg/index_header.md [new file with mode: 0644]
doxygen/siphon_templates/syscfg/item_format.md [new file with mode: 0644]
vlib/vlib/unix/cj.c
vlib/vlib/unix/cli.c
vlib/vlib/unix/dir.dox
vlib/vlib/unix/main.c

index 0a69c2d..97225f3 100644 (file)
 # Build the documentation
 #
 
 # Build the documentation
 #
 
+# Default target
+.PHONY: all
+all: doxygen
+
 # These should be passed in by the root Makefile
 WS_ROOT ?= $(CURDIR)/..
 BR ?= $(WS_ROOT)/build-root
 OS_ID ?= $(shell grep '^ID=' /etc/os-release | cut -f2- -d= | sed -e 's/\"//g')
 
 # Package dependencies
 # These should be passed in by the root Makefile
 WS_ROOT ?= $(CURDIR)/..
 BR ?= $(WS_ROOT)/build-root
 OS_ID ?= $(shell grep '^ID=' /etc/os-release | cut -f2- -d= | sed -e 's/\"//g')
 
 # Package dependencies
-DOC_DEB_DEPENDS = doxygen graphviz python-pyparsing
-DOC_RPM_DEPENDS = doxygen graphviz pyparsing
+DOC_DEB_DEPENDS = doxygen graphviz python-pyparsing python-jinja2
+DOC_RPM_DEPENDS = doxygen graphviz pyparsing python-jinja2
 
 # Doxygen configuration and our utility scripts
 DOXY_DIR ?= $(WS_ROOT)/doxygen
 
 # Doxygen configuration and our utility scripts
 DOXY_DIR ?= $(WS_ROOT)/doxygen
@@ -104,19 +108,22 @@ SIPHON_OUTPUT ?= $(DOXY_OUTPUT)/siphon_docs
 EXTRA_DOXY_INPUT += $(SIPHON_OUTPUT)
 
 # All the siphon types we know about
 EXTRA_DOXY_INPUT += $(SIPHON_OUTPUT)
 
 # All the siphon types we know about
-SIPHONS ?= clicmd
+SIPHONS ?= clicmd syscfg
 
 SIPHON_FILES = $(addprefix $(SIPHON_INPUT)/,$(addsuffix .siphon,$(SIPHONS)))
 SIPHON_DOCS = $(addprefix $(SIPHON_OUTPUT)/,$(addsuffix .md,$(SIPHONS)))
 
 
 SIPHON_FILES = $(addprefix $(SIPHON_INPUT)/,$(addsuffix .siphon,$(SIPHONS)))
 SIPHON_DOCS = $(addprefix $(SIPHON_OUTPUT)/,$(addsuffix .md,$(SIPHONS)))
 
-$(BR)/.doxygen-bootstrap.ok:
+$(BR)/.doxygen-bootstrap.ok: Makefile
        @echo "Checking whether dependencies for Doxygen are installed..."
 ifeq ($(OS_ID),ubuntu)
        @set -e; inst=; \
                for i in $(DOC_DEB_DEPENDS); do \
                        dpkg-query --show $$i >/dev/null 2>&1 || inst="$$inst $$i"; \
                done; \
        @echo "Checking whether dependencies for Doxygen are installed..."
 ifeq ($(OS_ID),ubuntu)
        @set -e; inst=; \
                for i in $(DOC_DEB_DEPENDS); do \
                        dpkg-query --show $$i >/dev/null 2>&1 || inst="$$inst $$i"; \
                done; \
-               if [ "$$inst" ]; then sudo apt-get $(CONFIRM) $(FORCE) install $$inst; fi
+               if [ "$$inst" ]; then \
+                       sudo apt-get update; \
+                       sudo apt-get $(CONFIRM) $(FORCE) install $$inst; \
+               fi
        @if [ ! -s /usr/lib/graphviz/config6a ]; then \
                echo "Rebuidlding system Graphviz configuration."; \
                sudo dot -c; \
        @if [ ! -s /usr/lib/graphviz/config6a ]; then \
                echo "Rebuidlding system Graphviz configuration."; \
                sudo dot -c; \
@@ -145,8 +152,12 @@ $(BR)/.doxygen-siphon.dep: Makefile
 # Include the source -> siphon dependencies
 -include $(BR)/.doxygen-siphon.dep
 
 # Include the source -> siphon dependencies
 -include $(BR)/.doxygen-siphon.dep
 
+# Generate .siphon files that contain fragments of source file that
+# relate to the siphons we support.
 .NOTPARALLEL: $(SIPHON_FILES)
 .NOTPARALLEL: $(SIPHON_FILES)
-$(SIPHON_FILES): $(DOXY_DIR)/siphon_generate.py $(BR)/.doxygen-bootstrap.ok
+$(SIPHON_FILES): $(BR)/.doxygen-bootstrap.ok \
+               $(DOXY_DIR)/siphon-generate \
+               $(wildcard $(DOXY_DIR)/siphon/*.py)
        @rm -rf "$(SIPHON_INPUT)" "$(SIPHON_OUTPUT)"
        @mkdir -p "$(SIPHON_INPUT)" "$(SIPHON_OUTPUT)"
        @touch $(SIPHON_INPUT)/files
        @rm -rf "$(SIPHON_INPUT)" "$(SIPHON_OUTPUT)"
        @mkdir -p "$(SIPHON_INPUT)" "$(SIPHON_OUTPUT)"
        @touch $(SIPHON_INPUT)/files
@@ -159,23 +170,33 @@ $(SIPHON_FILES): $(DOXY_DIR)/siphon_generate.py $(BR)/.doxygen-bootstrap.ok
                        >> $(SIPHON_INPUT)/files; \
        done
        @echo "Generating siphons..."
                        >> $(SIPHON_INPUT)/files; \
        done
        @echo "Generating siphons..."
-       @set -e; cd "$(WS_ROOT)"; $(DOXY_DIR)/siphon_generate.py \
+       @set -e; \
+       cd "$(WS_ROOT)"; \
+       $(DOXY_DIR)/siphon-generate \
                --output="$(SIPHON_INPUT)" \
                "@$(SIPHON_INPUT)/files"
 
                --output="$(SIPHON_INPUT)" \
                "@$(SIPHON_INPUT)/files"
 
-
+# Process the .siphon source fragments and render them into doxygen flavored
+# markdown documentation
 .DELETE_ON_ERROR: $(SIPHON_DOCS)
 .DELETE_ON_ERROR: $(SIPHON_DOCS)
-$(SIPHON_OUTPUT)/%.md: $(SIPHON_INPUT)/%.siphon $(DOXY_DIR)/siphon_process.py
+$(SIPHON_OUTPUT)/%.md: $(SIPHON_INPUT)/%.siphon \
+               $(DOXY_DIR)/siphon-process \
+               $(wildcard $(DOXY_DIR)/siphon/*.py) \
+               $(wildcard $(DOXY_DIR)/siphon_templates/*/*.md)
        @echo "Processing siphon from $(notdir $<)..."
        @echo "Processing siphon from $(notdir $<)..."
-       @set -e; cd "$(WS_ROOT)"; \
-               $(DOXY_DIR)/siphon_process.py --type=$(basename $(notdir $<)) \
-                       --output="$(SIPHON_OUTPUT)" $< > $@
+       @set -e; \
+       cd "$(WS_ROOT)"; \
+       $(DOXY_DIR)/siphon-process \
+               --type=$(basename $(notdir $<)) \
+               --output="$@" \
+               "$<"
 
 # This target can be used just to generate the siphoned docs
 .PHONY: doxygen-siphon
 doxygen-siphon: $(SIPHON_DOCS)
 
 # Generate the doxygen docs
 
 # This target can be used just to generate the siphoned docs
 .PHONY: doxygen-siphon
 doxygen-siphon: $(SIPHON_DOCS)
 
 # Generate the doxygen docs
+.PHONY: doxygen
 doxygen: $(SIPHON_DOCS)
        @mkdir -p "$(DOXY_OUTPUT)"
        @echo "Running Doxygen..."
 doxygen: $(SIPHON_DOCS)
        @mkdir -p "$(DOXY_OUTPUT)"
        @echo "Running Doxygen..."
@@ -189,6 +210,9 @@ doxygen: $(SIPHON_DOCS)
            VERSION="`git describe --tags --dirty`" \
            doxygen $(DOXY_DIR)/doxygen.cfg
 
            VERSION="`git describe --tags --dirty`" \
            doxygen $(DOXY_DIR)/doxygen.cfg
 
+.PHONY: wipe-doxygen
 wipe-doxygen:
        rm -rf "$(BR)/docs" "$(BR)/.doxygen-siphon.d"
 
 wipe-doxygen:
        rm -rf "$(BR)/docs" "$(BR)/.doxygen-siphon.d"
 
+.PHONY: clean
+clean: wipe-doxygen
index 500fe59..ccdd095 100644 (file)
@@ -27,3 +27,4 @@ This looks like a C file but it is not part of the build; it is purely
 for documentation.
 */
 /*? %%clicmd:group_label CLI section description%% ?*/
 for documentation.
 */
 /*? %%clicmd:group_label CLI section description%% ?*/
+/*? %%syscfg:group_label Startup config section description%% ?*/
index 8844965..7675b69 100644 (file)
@@ -244,6 +244,9 @@ ALIASES += "cliexcmd{1}=@clistart<b>vpp# <em>\1</em></b>@cliend"
 ALIASES += "cliexstart{1}=@cliexcmd{\1}@clistart"
 ALIASES += "cliexend=@cliend"
 
 ALIASES += "cliexstart{1}=@cliexcmd{\1}@clistart"
 ALIASES += "cliexend=@cliend"
 
+## Formatting for config directives
+ALIASES += "cfgcmd{2}=@par <code><pre>\1 \2</pre></code>"
+ALIASES += "cfgcmd{1}=@par <code><pre>\1</pre></code>"
 
 # This tag can be used to specify a number of word-keyword mappings (TCL only).
 # A mapping has the form "name=value". For example adding "class=itcl::class"
 
 # This tag can be used to specify a number of word-keyword mappings (TCL only).
 # A mapping has the form "name=value". For example adding "class=itcl::class"
diff --git a/doxygen/siphon-generate b/doxygen/siphon-generate
new file mode 100755 (executable)
index 0000000..bdfd58d
--- /dev/null
@@ -0,0 +1,74 @@
+#!/usr/bin/env python
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Looks for preprocessor macros with struct initializers and siphons them
+# off into another file for later parsing; ostensibly to generate
+# documentation from struct initializer data.
+
+import os, sys, argparse, logging
+import siphon
+
+DEFAULT_LOGFILE = None
+DEFAULT_LOGLEVEL = "info"
+DEFAULT_OUTPUT = "build-root/docs/siphons"
+DEFAULT_PREFIX = os.getcwd()
+
+ap = argparse.ArgumentParser()
+ap.add_argument("--log-file", default=DEFAULT_LOGFILE,
+        help="Log file [%s]" % DEFAULT_LOGFILE)
+ap.add_argument("--log-level", default=DEFAULT_LOGLEVEL,
+        choices=["debug", "info", "warning", "error", "critical"],
+        help="Logging level [%s]" % DEFAULT_LOGLEVEL)
+
+ap.add_argument("--output", '-o', metavar="directory", default=DEFAULT_OUTPUT,
+        help="Output directory for .siphon files [%s]" % DEFAULT_OUTPUT)
+ap.add_argument("--input-prefix", metavar="path", default=DEFAULT_PREFIX,
+        help="Prefix to strip from input pathnames [%s]" % DEFAULT_PREFIX)
+ap.add_argument("input", nargs='+', metavar="input_file",
+        help="Input C source files")
+args = ap.parse_args()
+
+logging.basicConfig(filename=args.log_file,
+        level=getattr(logging, args.log_level.upper(), None))
+log = logging.getLogger("siphon_generate")
+
+
+generate = siphon.generate.Generate(output_directory=args.output,
+    input_prefix=args.input_prefix)
+
+# Pre-process file names in case they indicate a file with
+# a list of files
+files = []
+for filename in args.input:
+    if filename.startswith('@'):
+        with open(filename[1:], 'r') as fp:
+            lines = fp.readlines()
+            for line in lines:
+                file = line.strip()
+                if file not in files:
+                    files.append(file)
+            lines = None
+    else:
+        if filename not in files:
+            files.append(filename)
+
+# Iterate all the input files we've been given
+for filename in files:
+    generate.parse(filename)
+
+# Write the extracted data
+generate.deliver()
+
+# All done
diff --git a/doxygen/siphon-process b/doxygen/siphon-process
new file mode 100755 (executable)
index 0000000..ea9df96
--- /dev/null
@@ -0,0 +1,67 @@
+#!/usr/bin/env python
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Filter for .siphon files that are generated by other filters.
+# The idea is to siphon off certain initializers so that we can better
+# auto-document the contents of that initializer.
+
+import os, sys, argparse, logging
+import siphon
+
+DEFAULT_LOGFILE = None
+DEFAULT_LOGLEVEL = "info"
+DEFAULT_SIPHON ="clicmd"
+DEFAULT_OUTPUT = None
+DEFAULT_TEMPLATES = os.path.dirname(__file__) + "/siphon_templates"
+
+ap = argparse.ArgumentParser()
+ap.add_argument("--log-file", default=DEFAULT_LOGFILE,
+        help="Log file [%s]" % DEFAULT_LOGFILE)
+ap.add_argument("--log-level", default=DEFAULT_LOGLEVEL,
+        choices=["debug", "info", "warning", "error", "critical"],
+        help="Logging level [%s]" % DEFAULT_LOGLEVEL)
+
+ap.add_argument("--type", '-t', metavar="siphon_type", default=DEFAULT_SIPHON,
+        choices=siphon.process.siphons.keys(),
+        help="Siphon type to process [%s]" % DEFAULT_SIPHON)
+ap.add_argument("--output", '-o', metavar="file", default=DEFAULT_OUTPUT,
+        help="Output file (uses stdout if not defined) [%s]" % DEFAULT_OUTPUT)
+ap.add_argument("--templates", metavar="directory", default=DEFAULT_TEMPLATES,
+        help="Path to render templates directory [%s]" % DEFAULT_TEMPLATES)
+ap.add_argument("input", nargs='+', metavar="input_file",
+        help="Input .siphon files")
+args = ap.parse_args()
+
+logging.basicConfig(filename=args.log_file,
+        level=getattr(logging, args.log_level.upper(), None))
+log = logging.getLogger("siphon_process")
+
+# Determine where to send the generated output
+if args.output is None:
+    out = sys.stdout
+else:
+    out = open(args.output, "w+")
+
+# Get our processor
+klass = siphon.process.siphons[args.type]
+processor = klass(template_directory=args.templates)
+
+# Load the input files
+processor.load_json(args.input)
+
+# Process the data
+processor.process(out=out)
+
+# All done
diff --git a/doxygen/siphon/__init__.py b/doxygen/siphon/__init__.py
new file mode 100644 (file)
index 0000000..437a1df
--- /dev/null
@@ -0,0 +1,24 @@
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Siphon classes
+
+import generate
+import generate_clicmd
+import generate_syscfg
+
+import parsers
+import process
+import process_clicmd
+import process_syscfg
diff --git a/doxygen/siphon/generate.py b/doxygen/siphon/generate.py
new file mode 100644 (file)
index 0000000..d6b6faf
--- /dev/null
@@ -0,0 +1,304 @@
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Generate .siphon source fragments for later processing
+
+import logging
+import os, sys, re, json
+
+"""List of (regexp, siphon_name) tuples for matching the start of C
+   initializer blocks in source files. Each siphon class registers
+   themselves on tihs list."""
+siphon_patterns = []
+
+class Generate(object):
+    """Matches a siphon comment block start"""
+    siphon_block_start = re.compile("^\s*/\*\?\s*(.*)$")
+
+    """Matches a siphon comment block stop"""
+    siphon_block_stop = re.compile("^(.*)\s*\?\*/\s*$")
+
+    """Siphon block directive delimiter"""
+    siphon_block_delimiter = "%%"
+
+    """Matches a siphon block directive such as
+       '%clicmd:group_label Debug CLI%'"""
+    siphon_block_directive = re.compile("(%s)\s*([a-zA-Z0-9_:]+)\s+(.*)\s*(%s)" % \
+            (siphon_block_delimiter, siphon_block_delimiter))
+
+    """Matches the start of an initializer block"""
+    siphon_initializer = re.compile("\s*=")
+
+    """Collated output for each siphon"""
+    output = None
+
+    """Directory prefix to strip from input filenames to keep things tidy."""
+    input_prefix = None
+
+    """List of known siphons"""
+    known_siphons = None
+
+    """Logging handler"""
+    log = None
+
+
+    def __init__(self, output_directory, input_prefix):
+        super(Generate, self).__init__()
+        self.log = logging.getLogger("siphon.generate")
+
+        # Build a list of known siphons
+        self.known_siphons = []
+        for item in siphon_patterns:
+            siphon = item[1]
+            if siphon not in self.known_siphons:
+                self.known_siphons.append(siphon)
+
+        # Setup information for siphons we know about
+        self.output = {}
+        for siphon in self.known_siphons:
+            self.output[siphon] = {
+                    "file": "%s/%s.siphon" % (output_directory, siphon),
+                    "global": {},
+                    "items": [],
+                }
+
+        self.input_prefix = input_prefix
+
+
+    """
+    count open and close braces in str
+    return (0, index) when braces were found and count becomes 0.
+    index indicates the position at which the last closing brace was
+    found.
+    return (-1, -1) if a closing brace is found before any opening one.
+    return (count, -1) if not all opening braces are closed, count is the
+    current depth
+    """
+    def count_braces(self, str, count=0, found=False):
+        for index in range(0, len(str)):
+            if str[index] == '{':
+                count += 1;
+                found = True
+            elif str[index] == '}':
+                if count == 0:
+                    # means we never found an open brace
+                    return (-1, -1)
+                count -= 1;
+
+            if count == 0 and found:
+                return (count, index)
+
+        return (count, -1)
+
+    def parse(self, filename):
+        # Strip the current directory off the start of the
+        # filename for brevity
+        if filename[0:len(self.input_prefix)] == self.input_prefix:
+            filename = filename[len(self.input_prefix):]
+            if filename[0] == "/":
+                filename = filename[1:]
+
+        # Work out the abbreviated directory name
+        directory = os.path.dirname(filename)
+        if directory[0:2] == "./":
+            directory = directory[2:]
+        elif directory[0:len(self.input_prefix)] == self.input_prefix:
+            directory = directory[len(self.input_prefix):]
+        if directory[0] == "/":
+            directory = directory[1:]
+
+        # Open the file and explore its contents...
+        self.log.info("Siphoning from %s." % filename)
+        directives = {}
+        with open(filename) as fd:
+            siphon = None
+            close_siphon = None
+            siphon_block = ""
+            in_block = False
+            line_num = 0
+            siphon_line = 0
+
+            for line in fd:
+                line_num += 1
+                str = line[:-1] # filter \n
+
+                """See if there is a block directive and if so extract it"""
+                def process_block_directive(str, directives):
+                    m = self.siphon_block_directive.search(str)
+                    if m is not None:
+                        k = m.group(2)
+                        v = m.group(3).strip()
+                        directives[k] = v
+                        # Return only the parts we did not match
+                        return str[0:m.start(1)] + str[m.end(4):]
+
+                    return str
+
+                def process_block_prefix(str):
+                    if str.startswith(" * "):
+                        str = str[3:]
+                    elif str == " *":
+                        str = ""
+                    return str
+
+                if not in_block:
+                    # See if the line contains the start of a siphon doc block
+                    m = self.siphon_block_start.search(str)
+                    if m is not None:
+                        in_block = True
+                        t = m.group(1)
+
+                        # Now check if the block closes on the same line
+                        m = self.siphon_block_stop.search(t)
+                        if m is not None:
+                            t = m.group(1)
+                            in_block = False
+
+                        # Check for directives
+                        t = process_block_directive(t, directives)
+
+                        # Filter for normal comment prefixes
+                        t = process_block_prefix(t)
+
+                        # Add what is left
+                        siphon_block += t
+
+                        # Skip to next line
+                        continue
+
+                else:
+                    # Check to see if we have an end block marker
+                    m = self.siphon_block_stop.search(str)
+                    if m is not None:
+                        in_block = False
+                        t = m.group(1)
+                    else:
+                        t = str
+
+                    # Check for directives
+                    t = process_block_directive(t, directives)
+
+                    # Filter for normal comment prefixes
+                    t = process_block_prefix(t)
+
+                    # Add what is left
+                    siphon_block += t + "\n"
+
+                    # Skip to next line
+                    continue
+
+
+                if siphon is None:
+                    # Look for blocks we need to siphon
+                    for p in siphon_patterns:
+                        if p[0].match(str):
+                            siphon = [ p[1], str + "\n", 0 ]
+                            siphon_line = line_num
+
+                            # see if we have an initializer
+                            m = self.siphon_initializer.search(str)
+                            if m is not None:
+                                # count the braces on this line
+                                (count, index) = \
+                                    self.count_braces(str[m.start():])
+                                siphon[2] = count
+                                # TODO - it's possible we have the
+                                # initializer all on the first line
+                                # we should check for it, but also
+                                # account for the possibility that
+                                # the open brace is on the next line
+                                #if count == 0:
+                                #    # braces balanced
+                                #    close_siphon = siphon
+                                #    siphon = None
+                            else:
+                                # no initializer: close the siphon right now
+                                close_siphon = siphon
+                                siphon = None
+                else:
+                    # See if we should end the siphon here - do we have
+                    # balanced braces?
+                    (count, index) = self.count_braces(str,
+                            count=siphon[2], found=True)
+                    if count == 0:
+                        # braces balanced - add the substring and
+                        # close the siphon
+                        siphon[1] += str[:index+1] + ";\n"
+                        close_siphon = siphon
+                        siphon = None
+                    else:
+                        # add the whole string, move on
+                        siphon[2] = count
+                        siphon[1] += str + "\n"
+
+                if close_siphon is not None:
+                    # Write the siphoned contents to the right place
+                    siphon_name = close_siphon[0]
+
+                    # Copy directives for the file
+                    details = {}
+                    for key in directives:
+                        if ":" in key:
+                            (sn, label) = key.split(":")
+                            if sn == siphon_name:
+                                details[label] = directives[key]
+                        else:
+                            details[key] = directives[key]
+
+                    # Copy details for this block
+                    details['file'] = filename
+                    details['directory'] = directory
+                    details['line_start'] = siphon_line
+                    details['line_end'] = line_num
+                    details['siphon_block'] = siphon_block.strip()
+                    details["block"] = close_siphon[1]
+
+                    # Store the item
+                    self.output[siphon_name]['items'].append(details)
+
+                    # All done
+                    close_siphon = None
+                    siphon_block = ""
+
+            # Update globals
+            for key in directives.keys():
+                if ':' not in key:
+                    continue
+
+                if filename.endswith("/dir.dox"):
+                    # very special! use the parent directory name
+                    l = directory
+                else:
+                    l = filename
+
+                (sn, label) = key.split(":")
+
+                if sn not in self.output:
+                    self.output[sn] = {}
+                if 'global' not in self.output[sn]:
+                    self.output[sn]['global'] = {}
+                if l not in self.output[sn]['global']:
+                    self.output[sn]['global'][l] = {}
+
+                self.output[sn]['global'][l][label] = directives[key]
+
+    def deliver(self):
+        # Write out the data
+        for siphon in self.output.keys():
+            self.log.info("Saving siphon data %s." % siphon)
+            s = self.output[siphon]
+            with open(s['file'], "a") as fp:
+                json.dump(s, fp,
+                    separators=(',', ': '), indent=4, sort_keys=True)
+
diff --git a/doxygen/siphon/generate_clicmd.py b/doxygen/siphon/generate_clicmd.py
new file mode 100644 (file)
index 0000000..7b13111
--- /dev/null
@@ -0,0 +1,22 @@
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import generate, re
+
+# Register our regexp
+generate.siphon_patterns.append((
+    re.compile("(?P<m>VLIB_CLI_COMMAND)\s*"
+        "[(](?P<name>[a-zA-Z0-9_]+)(,[^)]*)?[)]"),
+    "clicmd"
+))
diff --git a/doxygen/siphon/generate_syscfg.py b/doxygen/siphon/generate_syscfg.py
new file mode 100644 (file)
index 0000000..c77936a
--- /dev/null
@@ -0,0 +1,22 @@
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import generate, re
+
+# Register our regexp
+generate.siphon_patterns.append((
+    re.compile("(?P<m>VLIB_CONFIG_FUNCTION)\s*"
+        '[(](?P<fn>[a-zA-Z0-9_]+)\s*,\s*"(?P<name>[^"]*)"[)]'),
+    "syscfg"
+))
diff --git a/doxygen/siphon/parsers.py b/doxygen/siphon/parsers.py
new file mode 100644 (file)
index 0000000..6fe8600
--- /dev/null
@@ -0,0 +1,149 @@
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import cgi, pyparsing as pp
+
+# Some useful primitives
+ident = pp.Word(pp.alphas + "_", pp.alphas + pp.nums + "_")
+intNum = pp.Word(pp.nums)
+hexNum = pp.Literal("0x") + pp.Word(pp.hexnums)
+octalNum = pp.Literal("0") + pp.Word("01234567")
+integer = (hexNum | octalNum | intNum) + \
+    pp.Optional(pp.Literal("ULL") | pp.Literal("LL") | pp.Literal("L"))
+floatNum = pp.Regex(r'\d+(\.\d*)?([eE]\d+)?') + pp.Optional(pp.Literal("f"))
+char = pp.Literal("'") + pp.Word(pp.printables, exact=1) + pp.Literal("'")
+arrayIndex = integer | ident
+
+lbracket = pp.Literal("(").suppress()
+rbracket = pp.Literal(")").suppress()
+lbrace = pp.Literal("{").suppress()
+rbrace = pp.Literal("}").suppress()
+comma = pp.Literal(",").suppress()
+equals = pp.Literal("=").suppress()
+dot = pp.Literal(".").suppress()
+semicolon = pp.Literal(";").suppress()
+
+# initializer := { [member = ] (variable | expression | { initializer } ) }
+typeName = ident
+varName = ident
+typeSpec = pp.Optional("unsigned") + \
+           pp.oneOf("int long short float double char u8 i8 void") + \
+           pp.Optional(pp.Word("*"), default="")
+typeCast = pp.Combine( "(" + ( typeSpec | typeName ) + ")" ).suppress()
+
+string = pp.Combine(pp.OneOrMore(pp.QuotedString(quoteChar='"',
+    escChar='\\', multiline=True)), adjacent=False)
+literal = pp.Optional(typeCast) + (integer | floatNum | char | string)
+var = pp.Combine(pp.Optional(typeCast) + varName +
+    pp.Optional("[" + arrayIndex + "]"))
+
+# This could be more complete, but suffices for our uses
+expr = (literal | var)
+
+"""Parse and render a block of text into a Python dictionary."""
+class Parser(object):
+    """Compiled PyParsing BNF"""
+    _parser = None
+
+    def __init__(self):
+        super(Parser, self).__init__()
+        self._parser = self.BNF()
+
+    def BNF(self):
+        raise NotImplementedError
+
+    def item(self, item):
+        raise NotImplementedError
+
+    def parse(self, input):
+        item = self._parser.parseString(input).asList()
+        return self.item(item)
+
+
+"""Parser for function-like macros - without the closing semi-colon."""
+class ParserFunctionMacro(Parser):
+    def BNF(self):
+        # VLIB_CONFIG_FUNCTION (unix_config, "unix")
+        macroName = ident
+        params = pp.Group(pp.ZeroOrMore(expr + comma) + expr)
+        macroParams = lbracket + params + rbracket
+
+        return macroName + macroParams
+
+    def item(self, item):
+        r = {
+            "macro": item[0],
+            "name": item[1][1],
+            "function": item[1][0],
+        }
+
+        return r
+
+
+"""Parser for function-like macros with a closing semi-colon."""
+class ParseFunctionMacroStmt(ParserFunctionMacro):
+    def BNF(self):
+        # VLIB_CONFIG_FUNCTION (unix_config, "unix");
+        function_macro = super(ParseFunctionMacroStmt, self).BNF()
+        mi = function_macro + semicolon
+        mi.ignore(pp.cppStyleComment)
+
+        return mi
+
+
+"""
+Parser for our struct initializers which are composed from a
+function-like macro, equals sign, and then a normal C struct initalizer
+block.
+"""
+class MacroInitializer(ParserFunctionMacro):
+    def BNF(self):
+        # VLIB_CLI_COMMAND (show_sr_tunnel_command, static) = {
+        #    .path = "show sr tunnel",
+        #    .short_help = "show sr tunnel [name <sr-tunnel-name>]",
+        #    .function = show_sr_tunnel_fn,
+        # };
+        cs = pp.Forward()
+
+
+        member = pp.Combine(dot + varName + pp.Optional("[" + arrayIndex + "]"),
+            adjacent=False)
+        value = (expr | cs)
+
+        entry = pp.Group(pp.Optional(member + equals, default="") + value)
+        entries = (pp.ZeroOrMore(entry + comma) + entry + pp.Optional(comma)) | \
+                  (pp.ZeroOrMore(entry + comma))
+
+        cs << (lbrace + entries + rbrace)
+
+        macroName = ident
+        params = pp.Group(pp.ZeroOrMore(expr + comma) + expr)
+        macroParams = lbracket + params + rbracket
+
+        function_macro = super(MacroInitializer, self).BNF()
+        mi = function_macro + equals + pp.Group(cs) + semicolon
+        mi.ignore(pp.cppStyleComment)
+
+        return mi
+
+    def item(self, item):
+        r = {
+            "macro": item[0],
+            "name": item[1][0],
+            "params": item[2],
+            "value": {},
+        }
+
+        for param in item[2]:
+            r["value"][param[0]] = cgi.escape(param[1])
+
+        return r
diff --git a/doxygen/siphon/process.py b/doxygen/siphon/process.py
new file mode 100644 (file)
index 0000000..c7f8f1a
--- /dev/null
@@ -0,0 +1,271 @@
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Generation template class
+
+import logging, os,sys, cgi, json, jinja2, HTMLParser
+
+# Classes register themselves in this dictionary
+"""Mapping of known processors to their classes"""
+siphons = {}
+
+
+"""Generate rendered output for siphoned data."""
+class Siphon(object):
+
+    # Set by subclasses
+    """Our siphon name"""
+    name = None
+
+    # Set by subclasses
+    """Name of an identifier used by this siphon"""
+    identifier = None
+
+    # Set by subclasses
+    """The pyparsing object to use to parse with"""
+    _parser = None
+
+    """The input data"""
+    _cmds = None
+
+    """Group key to (directory,file) mapping"""
+    _group = None
+
+    """Logging handler"""
+    log = None
+
+    """Directory to look for siphon rendering templates"""
+    template_directory = None
+
+    """Template environment, if we're using templates"""
+    _tplenv = None
+
+    def __init__(self, template_directory=None):
+        super(Siphon, self).__init__()
+        self.log = logging.getLogger("siphon.process.%s" % self.name)
+
+        if template_directory is not None:
+          self.template_directory = template_directory
+          searchpath = [
+              template_directory + "/" + self.name,
+              template_directory + "/" + "default",
+          ]
+          loader = jinja2.FileSystemLoader(searchpath=searchpath)
+          self._tplenv = jinja2.Environment(
+              loader=loader,
+              trim_blocks=True,
+              keep_trailing_newline=True)
+
+          # Convenience, get a reference to the internal escape and
+          # unescape methods in cgi and HTMLParser. These then become
+          # available to templates to use, if needed.
+          self._h = HTMLParser.HTMLParser()
+          self.escape = cgi.escape
+          self.unescape = self._h.unescape
+
+
+    # Output renderers
+
+    """Returns an object to be used as the sorting key in the item index."""
+    def index_sort_key(self, group):
+        return group
+
+    """Returns a string to use as the header at the top of the item index."""
+    def index_header(self):
+        return self.template("index_header")
+
+    """Returns the string fragment to use for each section in the item
+    index."""
+    def index_section(self, group):
+        return self.template("index_section", group=group)
+
+    """Returns the string fragment to use for each entry in the item index."""
+    def index_entry(self, meta, item):
+        return self.template("index_entry", meta=meta, item=item)
+
+    """Returns an object, typically a string, to be used as the sorting key
+    for items within a section."""
+    def item_sort_key(self, item):
+        return item['name']
+
+    """Returns a key for grouping items together."""
+    def group_key(self, directory, file, macro, name):
+        _global = self._cmds['_global']
+
+        if file in _global and 'group_label' in _global[file]:
+            self._group[file] = (directory, file)
+            return file
+
+        self._group[directory] = (directory, None)
+        return directory
+
+    """Returns a key for identifying items within a grouping."""
+    def item_key(self, directory, file, macro, name):
+        return name
+
+    """Returns a string to use as the header when rendering the item."""
+    def item_header(self, group):
+        return self.template("item_header", group=group)
+
+    """Returns a string to use as the body when rendering the item."""
+    def item_format(self, meta, item):
+        return self.template("item_format", meta=meta, item=item)
+
+    """Returns a string to use as the label for the page reference."""
+    def page_label(self, group):
+        return "_".join((
+            self.name,
+            self.sanitize_label(group)
+        ))
+
+    """Returns a title to use for a page."""
+    def page_title(self, group):
+        _global = self._cmds['_global']
+        (directory, file) = self._group[group]
+
+        if file and file in _global and 'group_label' in _global[file]:
+            return _global[file]['group_label']
+
+        if directory in _global and 'group_label' in _global[directory]:
+            return _global[directory]['group_label']
+
+        return directory
+
+    """Returns a string to use as the label for the section reference."""
+    def item_label(self, group, item):
+        return "__".join((
+            self.name,
+            item
+        ))
+
+    """Label sanitizer; for creating Doxygen references"""
+    def sanitize_label(self, value):
+        return value.replace(" ", "_") \
+                    .replace("/", "_") \
+                    .replace(".", "_")
+
+    """Template processor"""
+    def template(self, name, **kwargs):
+      tpl = self._tplenv.get_template(name + ".md")
+      return tpl.render(
+            this=self,
+            **kwargs)
+
+
+    # Processing methods
+
+    """Parse the input file into a more usable dictionary structure."""
+    def load_json(self, files):
+        self._cmds = {}
+        self._group = {}
+
+        line_num = 0
+        line_start = 0
+        for filename in files:
+            filename = os.path.relpath(filename)
+            self.log.info("Parsing items in file \"%s\"." % filename)
+            data = None
+            with open(filename, "r") as fd:
+                data = json.load(fd)
+
+            self._cmds['_global'] = data['global']
+
+            # iterate the items loaded and regroup it
+            for item in data["items"]:
+                try:
+                    o = self._parser.parse(item['block'])
+                except:
+                    self.log.error("Exception parsing item: %s\n%s" \
+                            % (json.dumps(item, separators=(',', ': '),
+                                indent=4),
+                                item['block']))
+                    raise
+
+                # Augment the item with metadata
+                o["meta"] = {}
+                for key in item:
+                    if key == 'block':
+                        continue
+                    o['meta'][key] = item[key]
+
+                # Load some interesting fields
+                directory = item['directory']
+                file = item['file']
+                macro = o["macro"]
+                name = o["name"]
+
+                # Generate keys to group items by
+                group_key = self.group_key(directory, file, macro, name)
+                item_key = self.item_key(directory, file, macro, name)
+
+                if group_key not in self._cmds:
+                    self._cmds[group_key] = {}
+
+                self._cmds[group_key][item_key] = o
+
+    """Iterate over the input data, calling render methods to generate the
+    output."""
+    def process(self, out=None):
+
+        if out is None:
+            out = sys.stdout
+
+        # Accumulated body contents
+        contents = ""
+
+        # Write the header for this siphon type
+        out.write(self.index_header())
+
+        # Sort key helper for the index
+        def group_sort_key(group):
+            return self.index_sort_key(group)
+
+        # Iterate the dictionary and process it
+        for group in sorted(self._cmds.keys(), key=group_sort_key):
+            if group.startswith('_'):
+                continue
+
+            self.log.info("Processing items in group \"%s\" (%s)." % \
+                (group, group_sort_key(group)))
+
+            # Generate the section index entry (write it now)
+            out.write(self.index_section(group))
+
+            # Generate the item header (save for later)
+            contents += self.item_header(group)
+
+            def item_sort_key(key):
+                return self.item_sort_key(self._cmds[group][key])
+
+            for key in sorted(self._cmds[group].keys(), key=item_sort_key):
+                self.log.debug("--- Processing key \"%s\" (%s)." % \
+                    (key, item_sort_key(key)))
+
+                o = self._cmds[group][key]
+                meta = {
+                    "directory": o['meta']['directory'],
+                    "file": o['meta']['file'],
+                    "macro": o['macro'],
+                    "key": key,
+                    "label": self.item_label(group, key),
+                }
+
+                # Generate the index entry for the item (write it now)
+                out.write(self.index_entry(meta, o))
+
+                # Generate the item itself (save for later)
+                contents += self.item_format(meta, o)
+
+        # Deliver the accumulated body output
+        out.write(contents)
diff --git a/doxygen/siphon/process_clicmd.py b/doxygen/siphon/process_clicmd.py
new file mode 100644 (file)
index 0000000..9b3bd35
--- /dev/null
@@ -0,0 +1,56 @@
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Generate clicmd formatted output
+
+import process, parsers
+
+class SiphonCLICMD(process.Siphon):
+
+    name = "clicmd"
+    identifier = "VLIB_CLI_COMMAND"
+
+    def __init__(self, *args, **kwargs):
+        super(SiphonCLICMD, self).__init__(*args, **kwargs)
+        self._parser = parsers.MacroInitializer()
+
+
+    # Output renderers
+
+    def index_sort_key(self, group):
+        _global = self._cmds['_global']
+        if group not in self._group:
+            return group
+        (directory, file) = self._group[group]
+
+        if file in _global and 'group_label' in _global[file]:
+            return _global[file]['group_label']
+
+        if directory in _global and 'group_label' in _global[directory]:
+            return _global[directory]['group_label']
+
+        return group
+
+    def item_sort_key(self, item):
+        return item['value']['path']
+
+    def item_label(self, group, item):
+        return "_".join((
+            self.name,
+            self.sanitize_label(self._cmds[group][item]['value']['path'])
+        ))
+
+
+# Register our processor
+process.siphons["clicmd"] = SiphonCLICMD
diff --git a/doxygen/siphon/process_syscfg.py b/doxygen/siphon/process_syscfg.py
new file mode 100644 (file)
index 0000000..94be591
--- /dev/null
@@ -0,0 +1,30 @@
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Generate syscfg formatted output
+
+import process, parsers
+
+class SiphonSYSCFG(process.Siphon):
+
+    name = "syscfg"
+    identifier = "VLIB_CONFIG_FUNCTION"
+
+    def __init__(self, *args, **kwargs):
+        super(SiphonSYSCFG, self).__init__(*args, **kwargs)
+        self._parser = parsers.ParseFunctionMacroStmt()
+
+
+# Register our processor
+process.siphons["syscfg"] = SiphonSYSCFG
diff --git a/doxygen/siphon_generate.py b/doxygen/siphon_generate.py
deleted file mode 100755 (executable)
index 8b99911..0000000
+++ /dev/null
@@ -1,322 +0,0 @@
-#!/usr/bin/env python
-# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at:
-#
-#     http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-# Looks for preprocessor macros with struct initializers and siphons them
-# off into another file for later parsing; ostensibly to generate
-# documentation from struct initializer data.
-
-import os, sys, re, argparse, json
-
-DEFAULT_OUTPUT = "build-root/docs/siphons"
-DEFAULT_PREFIX = os.getcwd()
-
-ap = argparse.ArgumentParser()
-ap.add_argument("--output", '-o', metavar="directory", default=DEFAULT_OUTPUT,
-        help="Output directory for .siphon files [%s]" % DEFAULT_OUTPUT)
-ap.add_argument("--input-prefix", metavar="path", default=DEFAULT_PREFIX,
-        help="Prefix to strip from input pathnames [%s]" % DEFAULT_PREFIX)
-ap.add_argument("input", nargs='+', metavar="input_file",
-        help="Input C source files")
-args = ap.parse_args()
-
-"""Patterns that match the start of code blocks we want to siphon"""
-siphon_patterns = [
-    ( re.compile("(?P<m>VLIB_CLI_COMMAND)\s*[(](?P<name>[a-zA-Z0-9_]+)(,[^)]*)?[)]"), "clicmd" ),
-]
-
-"""Matches a siphon comment block start"""
-siphon_block_start = re.compile("^\s*/\*\?\s*(.*)$")
-
-"""Matches a siphon comment block stop"""
-siphon_block_stop = re.compile("^(.*)\s*\?\*/\s*$")
-
-"""Siphon block directive delimiter"""
-siphon_block_delimiter = "%%"
-
-"""Matches a siphon block directive such as '%clicmd:group_label Debug CLI%'"""
-siphon_block_directive = re.compile("(%s)\s*([a-zA-Z0-9_:]+)\s+(.*)\s*(%s)" % \
-        (siphon_block_delimiter, siphon_block_delimiter))
-
-"""Matches the start of an initializer block"""
-siphon_initializer = re.compile("\s*=")
-
-"""
-count open and close braces in str
-return (0, index) when braces were found and count becomes 0.
-index indicates the position at which the last closing brace was
-found.
-return (-1, -1) if a closing brace is found before any opening one.
-return (count, -1) if not all opening braces are closed, count is the
-current depth
-"""
-def count_braces(str, count=0, found=False):
-    for index in range(0, len(str)):
-        if str[index] == '{':
-            count += 1;
-            found = True
-        elif str[index] == '}':
-            if count == 0:
-                # means we never found an open brace
-                return (-1, -1)
-            count -= 1;
-
-        if count == 0 and found:
-            return (count, index)
-
-    return (count, -1)
-
-# Collated output for each siphon
-output = {}
-
-# Build a list of known siphons
-known_siphons = []
-for item in siphon_patterns:
-       siphon = item[1]
-       if siphon not in known_siphons:
-               known_siphons.append(siphon)
-
-# Setup information for siphons we know about
-for siphon in known_siphons:
-       output[siphon] = {
-            "file": "%s/%s.siphon" % (args.output, siphon),
-            "global": {},
-            "items": [],
-        }
-
-# Pre-process file names in case they indicate a file with
-# a list of files
-files = []
-for filename in args.input:
-    if filename.startswith('@'):
-        with open(filename[1:], 'r') as fp:
-            lines = fp.readlines()
-            for line in lines:
-                files.append(line.strip())
-            lines = None
-    else:
-        files.append(filename)
-
-# Iterate all the input files we've been given
-for filename in files:
-    # Strip the current directory off the start of the
-    # filename for brevity
-    if filename[0:len(args.input_prefix)] == args.input_prefix:
-        filename = filename[len(args.input_prefix):]
-        if filename[0] == "/":
-            filename = filename[1:]
-
-    # Work out the abbreviated directory name
-    directory = os.path.dirname(filename)
-    if directory[0:2] == "./":
-        directory = directory[2:]
-    elif directory[0:len(args.input_prefix)] == args.input_prefix:
-        directory = directory[len(args.input_prefix):]
-    if directory[0] == "/":
-       directory = directory[1:]
-
-    # Open the file and explore its contents...
-    sys.stderr.write("Siphoning from %s...\n" % filename)
-    directives = {}
-    with open(filename) as fd:
-        siphon = None
-        close_siphon = None
-        siphon_block = ""
-        in_block = False
-        line_num = 0
-        siphon_line = 0
-
-        for line in fd:
-            line_num += 1
-            str = line[:-1] # filter \n
-
-            """See if there is a block directive and if so extract it"""
-            def process_block_directive(str, directives):
-                m = siphon_block_directive.search(str)
-                if m is not None:
-                    k = m.group(2)
-                    v = m.group(3).strip()
-                    directives[k] = v
-                    # Return only the parts we did not match
-                    return str[0:m.start(1)] + str[m.end(4):]
-
-                return str
-
-            def process_block_prefix(str):
-                if str.startswith(" * "):
-                    str = str[3:]
-                elif str == " *":
-                    str = ""
-                return str
-                
-            if not in_block:
-                # See if the line contains the start of a siphon doc block
-                m = siphon_block_start.search(str)
-                if m is not None:
-                    in_block = True
-                    t = m.group(1)
-
-                    # Now check if the block closes on the same line
-                    m = siphon_block_stop.search(t)
-                    if m is not None:
-                        t = m.group(1)
-                        in_block = False
-
-                    # Check for directives
-                    t = process_block_directive(t, directives)
-
-                    # Filter for normal comment prefixes
-                    t = process_block_prefix(t)
-
-                    # Add what is left
-                    siphon_block += t
-
-                    # Skip to next line
-                    continue
-
-            else:
-                # Check to see if we have an end block marker
-                m = siphon_block_stop.search(str)
-                if m is not None:
-                    in_block = False
-                    t = m.group(1)
-                else:
-                    t = str
-
-                # Check for directives
-                t = process_block_directive(t, directives)
-
-                # Filter for normal comment prefixes
-                t = process_block_prefix(t)
-
-                # Add what is left
-                siphon_block += t + "\n"
-
-                # Skip to next line
-                continue
-
-
-            if siphon is None:
-                # Look for blocks we need to siphon
-                for p in siphon_patterns:
-                    if p[0].match(str):
-                        siphon = [ p[1], str + "\n", 0 ]
-                        siphon_line = line_num
-
-                        # see if we have an initializer
-                        m = siphon_initializer.search(str)
-                        if m is not None:
-                            # count the braces on this line
-                            (count, index) = count_braces(str[m.start():])
-                            siphon[2] = count
-                            # TODO - it's possible we have the initializer all on the first line
-                            # we should check for it, but also account for the possibility that
-                            # the open brace is on the next line
-                            #if count == 0:
-                            #    # braces balanced
-                            #    close_siphon = siphon
-                            #    siphon = None
-                        else:
-                            # no initializer: close the siphon right now
-                            close_siphon = siphon
-                            siphon = None
-            else:
-                # See if we should end the siphon here - do we have balanced
-                # braces?
-                (count, index) = count_braces(str, count=siphon[2], found=True)
-                if count == 0:
-                    # braces balanced - add the substring and close the siphon
-                    siphon[1] += str[:index+1] + ";\n"
-                    close_siphon = siphon
-                    siphon = None
-                else:
-                    # add the whole string, move on
-                    siphon[2] = count
-                    siphon[1] += str + "\n"
-
-            if close_siphon is not None:
-                # Write the siphoned contents to the right place
-                siphon_name = close_siphon[0]
-
-                # Copy directives for the file
-                details = {}
-                for key in directives:
-                    if ":" in key:
-                        (sn, label) = key.split(":")
-                        if sn == siphon_name:
-                            details[label] = directives[key]
-                    else:
-                        details[key] = directives[key]
-
-                # Copy details for this block
-                details['file'] = filename
-                details['line_start'] = siphon_line
-                details['line_end'] = line_num
-                details['siphon_block'] = siphon_block.strip()
-
-                # Some defaults
-                if "group" not in details:
-                    if "group_label" in details:
-                        # use the filename since group labels are mostly of file scope
-                        details['group'] = details['file']
-                    else:
-                       details['group'] = directory
-
-                if "group_label" not in details:
-                    details['group_label'] = details['group']
-
-                details["block"] = close_siphon[1]
-
-                # Store the item
-                output[siphon_name]['items'].append(details)
-
-                # All done
-                close_siphon = None
-                siphon_block = ""
-
-        # Update globals
-        for key in directives.keys():
-            if ':' not in key:
-                continue
-
-            if filename.endswith("/dir.dox"):
-                # very special! use the parent directory name
-                l = directory
-            else:
-                l = filename
-
-            (sn, label) = key.split(":")
-
-            if sn not in output:
-                output[sn] = {}
-            if 'global' not in output[sn]:
-                output[sn]['global'] = {}
-            if l not in output[sn]['global']:
-                output[sn]['global'][l] = {}
-            if 'file' not in output[sn]:
-                output[sn]['file'] = "%s/%s.siphon" % (args.output, sn)
-            if 'items' not in output[sn]:
-                output[sn]['items'] = []
-
-            output[sn]['global'][l][label] = directives[key]
-
-
-# Write out the data
-for siphon in output.keys():
-    sys.stderr.write("Saving siphon %s...\n" % siphon)
-    s = output[siphon]
-    with open(s['file'], "a") as fp:
-        json.dump(s, fp, separators=(',', ': '), indent=4, sort_keys=True)
-
-# All done
diff --git a/doxygen/siphon_process.py b/doxygen/siphon_process.py
deleted file mode 100755 (executable)
index 82a166d..0000000
+++ /dev/null
@@ -1,323 +0,0 @@
-#!/usr/bin/env python
-# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
-#
-# Licensed under the Apache License, Version 2.0 (the "License");
-# you may not use this file except in compliance with the License.
-# You may obtain a copy of the License at:
-#
-#     http://www.apache.org/licenses/LICENSE-2.0
-#
-# Unless required by applicable law or agreed to in writing, software
-# distributed under the License is distributed on an "AS IS" BASIS,
-# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-# See the License for the specific language governing permissions and
-# limitations under the License.
-
-# Filter for .siphon files that are generated by other filters.
-# The idea is to siphon off certain initializers so that we can better
-# auto-document the contents of that initializer.
-
-import os, sys, re, argparse, cgi, json
-import pyparsing as pp
-
-import pprint
-
-DEFAULT_SIPHON ="clicmd"
-DEFAULT_OUTPUT = None
-DEFAULT_PREFIX = os.getcwd()
-
-siphon_map = {
-    'clicmd': "VLIB_CLI_COMMAND",
-}
-
-ap = argparse.ArgumentParser()
-ap.add_argument("--type", '-t', metavar="siphon_type", default=DEFAULT_SIPHON,
-        choices=siphon_map.keys(),
-        help="Siphon type to process [%s]" % DEFAULT_SIPHON)
-ap.add_argument("--output", '-o', metavar="directory", default=DEFAULT_OUTPUT,
-        help="Output directory for .md files [%s]" % DEFAULT_OUTPUT)
-ap.add_argument("--input-prefix", metavar="path", default=DEFAULT_PREFIX,
-        help="Prefix to strip from input pathnames [%s]" % DEFAULT_PREFIX)
-ap.add_argument("input", nargs='+', metavar="input_file",
-        help="Input .siphon files")
-args = ap.parse_args()
-
-if args.output is None:
-    sys.stderr.write("Error: Siphon processor requires --output to be set.")
-    sys.exit(1)
-
-
-def clicmd_index_sort(cfg, group, dec):
-    if group in dec and 'group_label' in dec[group]:
-        return dec[group]['group_label']
-    return group
-
-def clicmd_index_header(cfg):
-    s = "# CLI command index\n"
-    s += "\n[TOC]\n"
-    return s
-
-def clicmd_index_section(cfg, group, md):
-    return "\n@subpage %s\n\n" % md
-
-def clicmd_index_entry(cfg, meta, item):
-    v = item["value"]
-    return "* [%s](@ref %s)\n" % (v["path"], meta["label"])
-
-def clicmd_sort(cfg, meta, item):
-    return item['value']['path']
-
-def clicmd_header(cfg, group, md, dec):
-    if group in dec and 'group_label' in dec[group]:
-        label = dec[group]['group_label']
-    else:
-        label = group
-    return "\n@page %s %s\n" % (md, label)
-
-def clicmd_format(cfg, meta, item):
-    v = item["value"]
-    s = "\n@section %s %s\n" % (meta['label'], v['path'])
-
-    # The text from '.short_help = '.
-    # Later we should split this into short_help and usage_help
-    # since the latter is how it is primarily used but the former
-    # is also needed.
-    if "short_help" in v:
-        tmp = v["short_help"].strip()
-
-        # Bit hacky. Add a trailing period if it doesn't have one.
-        if tmp[-1] != ".":
-            tmp += "."
-
-        s += "### Summary/usage\n    %s\n\n" % tmp
-
-    # This is seldom used and will likely be deprecated
-    if "long_help" in v:
-        tmp = v["long_help"]
-
-        s += "### Long help\n    %s\n\n" % tmp
-
-    # Extracted from the code in /*? ... ?*/ blocks
-    if "siphon_block" in item["meta"]:
-        sb = item["meta"]["siphon_block"]
-
-        if sb != "":
-            # hack. still needed?
-            sb = sb.replace("\n", "\\n")
-            try:
-                sb = json.loads('"'+sb+'"')
-                s += "### Description\n%s\n\n" % sb
-            except:
-                pass
-
-    # Gives some developer-useful linking
-    if "item" in meta or "function" in v:
-        s += "### Declaration and implementation\n\n"
-
-        if "item" in meta:
-            s += "Declaration: @ref %s (%s:%d)\n\n" % \
-                (meta['item'], meta["file"], int(item["meta"]["line_start"]))
-
-        if "function" in v:
-            s += "Implementation: @ref %s.\n\n" % v["function"]
-
-    return s
-
-
-siphons = {
-    "VLIB_CLI_COMMAND": {
-        "index_sort_key": clicmd_index_sort,
-        "index_header": clicmd_index_header,
-        "index_section": clicmd_index_section,
-        "index_entry": clicmd_index_entry,
-        'sort_key': clicmd_sort,
-        "header": clicmd_header,
-        "format": clicmd_format,
-    }
-}
-
-
-# PyParsing definition for our struct initializers which look like this:
-# VLIB_CLI_COMMAND (show_sr_tunnel_command, static) = {
-#    .path = "show sr tunnel",
-#    .short_help = "show sr tunnel [name <sr-tunnel-name>]",
-#    .function = show_sr_tunnel_fn,
-#};
-def getMacroInitializerBNF():
-    cs = pp.Forward()
-    ident = pp.Word(pp.alphas + "_", pp.alphas + pp.nums + "_")
-    intNum = pp.Word(pp.nums)
-    hexNum = pp.Literal("0x") + pp.Word(pp.hexnums)
-    octalNum = pp.Literal("0") + pp.Word("01234567")
-    integer = (hexNum | octalNum | intNum) + \
-        pp.Optional(pp.Literal("ULL") | pp.Literal("LL") | pp.Literal("L"))
-    floatNum = pp.Regex(r'\d+(\.\d*)?([eE]\d+)?') + pp.Optional(pp.Literal("f"))
-    char = pp.Literal("'") + pp.Word(pp.printables, exact=1) + pp.Literal("'")
-    arrayIndex = integer | ident
-
-    lbracket = pp.Literal("(").suppress()
-    rbracket = pp.Literal(")").suppress()
-    lbrace = pp.Literal("{").suppress()
-    rbrace = pp.Literal("}").suppress()
-    comma = pp.Literal(",").suppress()
-    equals = pp.Literal("=").suppress()
-    dot = pp.Literal(".").suppress()
-    semicolon = pp.Literal(";").suppress()
-
-    # initializer := { [member = ] (variable | expression | { initializer } ) }
-    typeName = ident
-    varName = ident
-
-    typeSpec = pp.Optional("unsigned") + \
-               pp.oneOf("int long short float double char u8 i8 void") + \
-               pp.Optional(pp.Word("*"), default="")
-    typeCast = pp.Combine( "(" + ( typeSpec | typeName ) + ")" ).suppress()
-
-    string = pp.Combine(pp.OneOrMore(pp.QuotedString(quoteChar='"',
-        escChar='\\', multiline=True)), adjacent=False)
-    literal = pp.Optional(typeCast) + (integer | floatNum | char | string)
-    var = pp.Combine(pp.Optional(typeCast) + varName + pp.Optional("[" + arrayIndex + "]"))
-
-    expr = (literal | var) # TODO
-
-
-    member = pp.Combine(dot + varName + pp.Optional("[" + arrayIndex + "]"), adjacent=False)
-    value = (expr | cs)
-
-    entry = pp.Group(pp.Optional(member + equals, default="") + value)
-    entries = (pp.ZeroOrMore(entry + comma) + entry + pp.Optional(comma)) | \
-              (pp.ZeroOrMore(entry + comma))
-
-    cs << (lbrace + entries + rbrace)
-
-    macroName = ident
-    params = pp.Group(pp.ZeroOrMore(expr + comma) + expr)
-    macroParams = lbracket + params + rbracket
-
-    mi = macroName + pp.Optional(macroParams) + equals + pp.Group(cs) + semicolon
-    mi.ignore(pp.cppStyleComment)
-    return mi
-
-
-mi = getMacroInitializerBNF()
-
-# Parse the input file into a more usable dictionary structure
-cmds = {}
-line_num = 0
-line_start = 0
-for filename in args.input:
-    sys.stderr.write("Parsing items in file \"%s\"...\n" % filename)
-    data = None
-    with open(filename, "r") as fd:
-        data = json.load(fd)
-
-    cmds['_global'] = data['global']
-
-    # iterate the items loaded and regroup it
-    for item in data["items"]:
-        try:
-            o = mi.parseString(item['block']).asList()
-        except:
-            sys.stderr.write("Exception parsing item: %s\n%s\n" \
-                    % (json.dumps(item, separators=(',', ': '), indent=4),
-                        item['block']))
-            raise
-
-        group = item['group']
-        file = item['file']
-        macro = o[0]
-        param = o[1][0]
-
-        if group not in cmds:
-            cmds[group] = {}
-
-        if file not in cmds[group]:
-            cmds[group][file] = {}
-
-        if macro not in cmds[group][file]:
-            cmds[group][file][macro] = {}
-
-        c = {
-            'params': o[2],
-            'meta': {},
-            'value': {},
-        }
-
-        for key in item:
-            if key == 'block':
-                continue
-            c['meta'][key] = item[key]
-
-        for i in c['params']:
-            c['value'][i[0]] = cgi.escape(i[1])
-
-        cmds[group][file][macro][param] = c
-
-
-# Write the header for this siphon type
-cfg = siphons[siphon_map[args.type]]
-sys.stdout.write(cfg["index_header"](cfg))
-contents = ""
-
-def group_sort_key(item):
-    if "index_sort_key" in cfg:
-        return cfg["index_sort_key"](cfg, item, cmds['_global'])
-    return item
-
-# Iterate the dictionary and process it
-for group in sorted(cmds.keys(), key=group_sort_key):
-    if group.startswith('_'):
-        continue
-
-    sys.stderr.write("Processing items in group \"%s\"...\n" % group)
-
-    cfg = siphons[siphon_map[args.type]]
-    md = group.replace("/", "_").replace(".", "_")
-    sys.stdout.write(cfg["index_section"](cfg, group, md))
-
-    if "header" in cfg:
-        dec = cmds['_global']
-        contents += cfg["header"](cfg, group, md, dec)
-
-    for file in sorted(cmds[group].keys()):
-        if group.startswith('_'):
-            continue
-
-        sys.stderr.write("- Processing items in file \"%s\"...\n" % file)
-
-        for macro in sorted(cmds[group][file].keys()):
-            if macro != siphon_map[args.type]:
-                continue
-            sys.stderr.write("-- Processing items in macro \"%s\"...\n" % macro)
-            cfg = siphons[macro]
-
-            meta = {
-                "group": group,
-                "file": file,
-                "macro": macro,
-                "md": md,
-            }
-
-            def item_sort_key(item):
-                if "sort_key" in cfg:
-                    return cfg["sort_key"](cfg, meta, cmds[group][file][macro][item])
-                return item
-
-            for param in sorted(cmds[group][file][macro].keys(), key=item_sort_key):
-                sys.stderr.write("--- Processing item \"%s\"...\n" % param)
-
-                meta["item"] = param
-
-                # mangle "md" and the item to make a reference label
-                meta["label"] = "%s___%s" % (meta["md"], param)
-
-                if "index_entry" in cfg:
-                    s = cfg["index_entry"](cfg, meta, cmds[group][file][macro][param])
-                    sys.stdout.write(s)
-
-                if "format" in cfg:
-                    contents += cfg["format"](cfg, meta, cmds[group][file][macro][param])
-
-sys.stdout.write(contents)
-
-# All done
diff --git a/doxygen/siphon_templates/clicmd/index_entry.md b/doxygen/siphon_templates/clicmd/index_entry.md
new file mode 100644 (file)
index 0000000..1fa9ec9
--- /dev/null
@@ -0,0 +1,17 @@
+{#
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#}
+{% set v = item['value'] %}
+{{ "* [%s](@ref %s)" % (v['path'], meta["label"]) }}
diff --git a/doxygen/siphon_templates/clicmd/index_header.md b/doxygen/siphon_templates/clicmd/index_header.md
new file mode 100644 (file)
index 0000000..4167f4d
--- /dev/null
@@ -0,0 +1,130 @@
+{#
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#}
+# Debug CLI    {{'{#'}}clicmd}
+
+The VPP network stack comes equipped with a set of commands that are useful
+for debugging.
+
+The easiest way to access the CLI (with proper permissions) is to use the
+vppctl command:
+
+```
+sudo vppctl <cli-command>
+```
+
+The CLI parser matches static keyword strings, eventually invoking an action
+function. Unambiguous partial keyword matching always occurs. The action
+functions consume input until satisfied or until they fail. This model makes
+for easy coding, but does not guarantee useful "help" output. It's up to the
+CLI command writer to add useful help strings.
+
+You can find the source code of CLI commands by searching for instances of the
+@c VLIB_CLI_COMMAND macro in the code source files.
+
+Please help maintain and improve this document to make and keep these commands
+clear and useful!
+
+@todo Document where to modify this CLI intro text.
+
+
+## Debug and Telnet CLI
+
+The debug CLI is enabled with the unix interactive parameter or startup
+configuration option. This causes VPP to start without daemonizing and
+presents a command line interface on the terminal where it is run.
+
+The Telnet CLI is enabled with the `cli-listen localhost:5002` option which
+will cause VPP to listen for TCP connections on the localhost address port
+@c 5002. A Telnet client can then connect to this port (for example, `telnet
+localhost 5002`) and will receive a command line prompt.
+
+This configuration will enable both mechanisms:
+
+```
+unix {
+  interactive
+  cli-listen localhost:5002
+}
+```
+
+The debug CLI can operate in line mode, which may be useful when running
+inside an IDE like Emacs. This is enabled with the option
+`unix cli-line-mode`. Several other options exist that alter how this
+CLI works, see the @ref syscfg section for details.
+
+The CLI starts with a banner graphic (which can be disabled) and a prompt. The
+prompt will typically read `vpp` for a release version of VPP and `DBGvpp#`
+for a development version with debugging enabled, for example:
+
+        _______    _        _   _____  ___ 
+     __/ __/ _ \  (_)__    | | / / _ \/ _ \
+     _/ _// // / / / _ \   | |/ / ___/ ___/
+     /_/ /____(_)_/\___/   |___/_/  /_/    
+    
+    vpp# 
+
+versus:
+
+        _______    _        _   _____  ___ 
+     __/ __/ _ \  (_)__    | | / / _ \/ _ \
+     _/ _// // / / / _ \   | |/ / ___/ ___/
+     /_/ /____(_)_/\___/   |___/_/  /_/    
+    
+    DBGvpp# 
+
+This prompt can be configured with the `unix cli-prompt` setting and the
+banner is disabled with `unix cli-no-banner`.
+
+## CLI features
+
+The CLI has several editing features that make it easy to use.
+
+- Cursor keys left/right will move the cursor within a command line;
+  typing will insert at the cursor; erase will erase at the cursor.
+
+- Ctrl-left/right will search for the start of the next word to
+  the left or right.
+- Home/end will jump the cursor to the start and end of the line.
+- Cursor keys up/down and ^P/^N iterate through the command history
+  buffer. Lines from the history buffer may be edited. New commands
+  are added to the end of the buffer when executed; though
+  duplicates of the previous command are not added.
+- ^U erases the line contents from the left of the cursor to the
+  start.
+- ^K erases the contents from the cursor to the end.
+- ^S/^R will search the command history forwards or in reverse for
+  a command; start typing for matches to auto complete.
+- ^L will clear the screen (if supported by the terminal) and repaint
+  the prompt and any current line. The cursor position is also
+  retained.
+- The CLI can be closed with the quit command. Alternatively, ^D on
+  an empty input line will also close the session. Closing the debug
+  session will also shutdown VPP.
+
+Output that exceeds the length of a terminal page will be buffered, up to a
+limit.
+
+- Space or page-down displays the next page.
+- Enter or down-arrow displays the next line.
+- Page-up goes back a page.
+- Up-arrow goes up a line.
+- Home/end jump to the start/end of the buffered output.
+- The key q quits the pager. Space and enter will also quit the
+  pager if the end of the buffer has been reached.
+
+## Index of CLI commands
+
+[TOC]
diff --git a/doxygen/siphon_templates/clicmd/item_format.md b/doxygen/siphon_templates/clicmd/item_format.md
new file mode 100644 (file)
index 0000000..77d0484
--- /dev/null
@@ -0,0 +1,59 @@
+{#
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#}
+{% set v = item['value'] %}
+{{ "@section %s %s" % (meta['label'], v['path']) }}
+{% if 'short_help' in v %}
+
+### Summary/usage
+
+{% set str = v['short_help'] %}
+{% set period = "." if str[-1] != "." else "" %}
+{% set prefix = "    " if "[" in str or "&lt;" in str or "|" in str else "" %}
+{% set str = this.unescape(str) %}
+{{ "%s%s%s" % (prefix, str, period) }}
+{% endif %}
+{% if 'long_help' in v %}
+{# This is seldom used and will likely be deprecated #}
+
+### Long help
+
+{{ v['long_help'] }}
+{%- endif %}
+{% if 'siphon_block' in item['meta'] %}
+{% set sb = item["meta"]["siphon_block"] %}
+{% if sb %}
+{# Extracted from the code in /*? ... ?*/ blocks #}
+
+### Description
+
+{{ sb }}
+{% endif %}
+{% endif %}
+{% if "item" in meta or "function" in v %}
+{# Gives some developer-useful linking #}
+
+### Declaration and implementation
+{% if "item" in meta %}
+
+{{ "Declaration: @ref %s (@ref %s line %d)" %
+   (meta['item'], meta["file"], item["meta"]["line_start"]) }}
+{% endif %}
+{% if "function" in v %}
+
+{{ "Implementation: @ref %s." % v["function"] }}
+{% endif %}
+{% endif %}
+
diff --git a/doxygen/siphon_templates/default/index_entry.md b/doxygen/siphon_templates/default/index_entry.md
new file mode 100644 (file)
index 0000000..479dcdb
--- /dev/null
@@ -0,0 +1,16 @@
+{#
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#}
+{{ "* [%s](@ref %s)" % (item["name"], meta["label"]) }}
diff --git a/doxygen/siphon_templates/default/index_section.md b/doxygen/siphon_templates/default/index_section.md
new file mode 100644 (file)
index 0000000..3c9d2b4
--- /dev/null
@@ -0,0 +1,18 @@
+{#
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#}
+
+@subpage {{ this.page_label(group) }}
+
diff --git a/doxygen/siphon_templates/default/item_format.md b/doxygen/siphon_templates/default/item_format.md
new file mode 100644 (file)
index 0000000..ed1b1bf
--- /dev/null
@@ -0,0 +1,16 @@
+{#
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#}
+{{ raise NotImplementedError }}
diff --git a/doxygen/siphon_templates/default/item_header.md b/doxygen/siphon_templates/default/item_header.md
new file mode 100644 (file)
index 0000000..0c21e51
--- /dev/null
@@ -0,0 +1,18 @@
+{#
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#}
+
+{{ "@page %s %s" % (this.page_label(group), this.page_title(group)) }}
+
diff --git a/doxygen/siphon_templates/syscfg/index_header.md b/doxygen/siphon_templates/syscfg/index_header.md
new file mode 100644 (file)
index 0000000..5d338a0
--- /dev/null
@@ -0,0 +1,111 @@
+{#
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#}
+# Startup Configuration    {{'{#'}}syscfg}
+
+The VPP network stack comes with several configuration options that can be
+provided either on the command line or in a configuration file.
+
+Specific applications built on the stack have been known to require a dozen
+arguments, depending on requirements. This section describes commonly-used
+options and parameters.
+
+You can find command-line argument parsers in the source code by searching for
+instances of the `VLIB_CONFIG_FUNCTION` macro. The invocation
+`VLIB_CONFIG_FUNCTION(foo_config, "foo")` will cause the function
+`foo_config` to receive all the options and values supplied in a parameter
+block named "`foo`", for example: `foo { arg1 arg2 arg3 ... }`.
+
+@todo Tell the nice people where this document lives so that the might
+help improve it!
+
+## Command-line arguments
+
+Parameters are grouped by a section name. When providing more than one
+parameter to a section all parameters for that section must be wrapped in
+curly braces.
+
+```
+/usr/bin/vpp unix { interactive cli-listen 127.0.0.1:5002 }
+```
+
+Which will produce output similar to this:
+
+    <startup diagnostic messages>
+        _______    _        _   _____  ___ 
+     __/ __/ _ \  (_)__    | | / / _ \/ _ \
+     _/ _// // / / / _ \   | |/ / ___/ ___/
+     /_/ /____(_)_/\___/   |___/_/  /_/    
+    
+    vpp# <start-typing>
+
+When providing only one such parameter the braces are optional. For example,
+the following command argument, `unix interactive` does not have braces:
+
+```
+/usr/bin/vpp unix interactive
+```
+
+The command line can be presented as a single string or as several; anything
+given on the command line is concatenated with spaces into a single string
+before parsing.
+
+VPP applications must be able to locate their own executable images. The
+simplest way to ensure this will work is to invoke a VPP application by giving
+its absolute path; for example: `/usr/bin/vpp <options>`. At startup, VPP
+applications parse through their own ELF-sections (primarily) to make lists
+of init, configuration, and exit handlers.
+
+When developing with VPP, in _gdb_ it's often sufficient to start an application
+like this at the `(gdb)` prompt:
+
+```
+run unix interactive
+```
+
+## Configuration file
+
+It is also possible to supply parameters in a startup configuration file the
+path of which is provided to the VPP application on its command line.
+
+The format of the configuration file is a simple text file with the same
+content as the command line but with the benefit of being able to use newlines
+to make the content easier to read. For example:
+
+```
+unix {
+  nodaemon
+  log /tmp/vpp.log
+  full-coredump
+  cli-listen localhost:5002
+}
+api-trace {
+  on
+}
+dpdk {
+  dev 0000:03:00.0
+}
+```
+
+VPP is then instructed to load this file with the `-c` option:
+
+```
+/usr/bin/vpp -c /etc/vpp/startup.conf
+```
+
+## Index of startup command sections
+
+[TOC]
+
diff --git a/doxygen/siphon_templates/syscfg/item_format.md b/doxygen/siphon_templates/syscfg/item_format.md
new file mode 100644 (file)
index 0000000..5d3bb5c
--- /dev/null
@@ -0,0 +1,42 @@
+{#
+# Copyright (c) 2016 Comcast Cable Communications Management, LLC.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at:
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#}
+{% set v = item['value'] %}
+{{ "@section %s %s" % (meta['label'], item['name']) }}
+{% if 'siphon_block' in item['meta'] %}
+{% set sb = item["meta"]["siphon_block"] %}
+{% if sb %}
+{# Extracted from the code in /*? ... ?*/ blocks #}
+
+### Description
+
+{{ sb }}
+{% endif %}
+{% endif %}
+{% if "item" in meta or "function" in item %}
+{# Gives some developer-useful linking #}
+
+### Declaration and implementation
+{% if "item" in meta %}
+
+{{ "Declaration: @ref %s (@ref %s line %d)" %
+   (meta['item'], meta["file"], item["meta"]["line_start"]) }}
+{% endif %}
+{% if "function" in item %}
+
+{{ "Implementation: @ref %s." % item["function"] }}
+{% endif %}
+{% endif %}
+
index 553b450..33ba163 100644 (file)
  *------------------------------------------------------------------
  */
 
  *------------------------------------------------------------------
  */
 
+/**
+ * @file
+ * Circular joournal diagnostic mechanism.
+ *
+ * The @c cj thread-safe circular log buffer scheme is occasionally useful
+ * when chasing bugs. Calls to it should not be checked in.
+ */
+/*? %%clicmd:group_label Circular Journal %% ?*/
+/*? %%syscfg:group_label Circular Journal %% ?*/
+
 #include <stdio.h>
 #include <vlib/vlib.h>
 
 #include <stdio.h>
 #include <vlib/vlib.h>
 
@@ -94,6 +104,18 @@ cj_config (vlib_main_t * vm, unformat_input_t * input)
   return 0;
 }
 
   return 0;
 }
 
+/*?
+ * Configure the circular journal diagnostic mechanism. This is only useful
+ * if you, the deveoper, have written code to make use of the circular
+ * journal.
+ *
+ * @cfgcmd{records, &lt;number&gt;}
+ * Configure the number of records to allocate for the circular journal.
+ *
+ * @cfgcmd{on}
+ * Enable the collection of records in the circular journal at the
+ * earliest opportunity.
+?*/
 VLIB_CONFIG_FUNCTION (cj_config, "cj");
 
 void
 VLIB_CONFIG_FUNCTION (cj_config, "cj");
 
 void
@@ -220,10 +242,21 @@ cj_command_fn (vlib_main_t * vm,
   return 0;
 }
 
   return 0;
 }
 
+/*?
+ * Enable, disable the collection of diagnostic data into a
+ * circular journal or dump the circular journal diagnostic data.
+ * This is only useful if you, the deveoper, have written code to make
+ * use of the circular journal.
+ *
+ * When dumping the data it is formatted and sent to @c stderr of the
+ * VPP process; when running VPP in <code>unix interactive</code> mode
+ * this is typically the same place as the Debug CLI.
+?*/
+
 /* *INDENT-OFF* */
 VLIB_CLI_COMMAND (cj_command,static) = {
   .path = "cj",
 /* *INDENT-OFF* */
 VLIB_CLI_COMMAND (cj_command,static) = {
   .path = "cj",
-  .short_help = "cj",
+  .short_help = "cj <enable | disable | dump>",
   .function = cj_command_fn,
 };
 /* *INDENT-ON* */
   .function = cj_command_fn,
 };
 /* *INDENT-ON* */
index bf09ee0..69fca6e 100644 (file)
@@ -42,7 +42,8 @@
  * Provides a command line interface so humans can interact with VPP.
  * This is predominantly a debugging and testing mechanism.
  */
  * Provides a command line interface so humans can interact with VPP.
  * This is predominantly a debugging and testing mechanism.
  */
-/*? %%clicmd:group_label Debug CLI %% ?*/
+/*? %%clicmd:group_label Command line session %% ?*/
+/*? %%syscfg:group_label Command line session %% ?*/
 
 #include <vlib/vlib.h>
 #include <vlib/unix/unix.h>
 
 #include <vlib/vlib.h>
 #include <vlib/unix/unix.h>
@@ -2504,6 +2505,9 @@ unix_cli_config (vlib_main_t * vm, unformat_input_t * input)
   return 0;
 }
 
   return 0;
 }
 
+/*?
+ * This module has no configurable parameters.
+?*/
 VLIB_CONFIG_FUNCTION (unix_cli_config, "unix-cli");
 
 /** Called when VPP is shutting down, this restores the system
 VLIB_CONFIG_FUNCTION (unix_cli_config, "unix-cli");
 
 /** Called when VPP is shutting down, this restores the system
index cdded0f..1380fa5 100644 (file)
@@ -23,5 +23,6 @@
 VLIB application library Unix interface layer.
 
 */
 VLIB application library Unix interface layer.
 
 */
-/*? %%clicmd:group_label VLIB Unix stuff%% ?*/
+/*? %%clicmd:group_label Unix Interface %% ?*/
+/*? %%syscfg:group_label Unix Interface %% ?*/
 
 
index 3087c28..562778e 100644 (file)
@@ -407,6 +407,59 @@ unix_config (vlib_main_t * vm, unformat_input_t * input)
 }
 
 /* unix { ... } configuration. */
 }
 
 /* unix { ... } configuration. */
+/*?
+ *
+ * @cfgcmd{interactive}
+ * Attach CLI to stdin/out and provide a debugging command line interface.
+ * Implies @c nodaemon.
+ *
+ * @cfgcmd{nodaemon}
+ * Do not fork or background the VPP process. Typically used when invoking
+ * VPP applications from a process monitor.
+ *
+ * @cfgcmd{exec, &lt;filename&gt;}
+ * @par <code>startup-config &lt;filename&gt;</code>
+ * Read startup operational configuration from @c filename.
+ * The contents of the file will be performed as though entered at the CLI.
+ * The two keywords are aliases for the same function; if both are specified,
+ * only the last will have an effect.
+ *
+ * @cfgcmd{log, &lt;filename&gt;}
+ * Logs the startup configuration and all subsequent CLI commands in
+ * @c filename.
+ * Very useful in situations where folks don't remember or can't be bothered
+ * to include CLI commands in bug reports.
+ *
+ * @cfgcmd{full-coredump}
+ * Ask the Linux kernel to dump all memory-mapped address regions, instead
+ * of just text+data+bss.
+ *
+ * @cfgcmd{cli-listen, &lt;address:port&gt;}
+ * Bind the CLI to listen at the address and port given. @clocalhost
+ * on TCP port @c 5002, given as <tt>cli-listen localhost:5002</tt>,
+ * is typical.
+ *
+ * @cfgcmd{cli-line-mode}
+ * Disable character-by-character I/O on stdin. Useful when combined with,
+ * for example, <tt>emacs M-x gud-gdb</tt>.
+ *
+ * @cfgcmd{cli-prompt, &lt;string&gt;}
+ * Configure the CLI prompt to be @c string.
+ *
+ * @cfgcmd{cli-history-limit, &lt;nn&gt;}
+ * Limit commmand history to @c nn  lines. A value of @c 0
+ * disables command history. Default value: @c 50
+ *
+ * @cfgcmd{cli-no-banner}
+ * Disable the login banner on stdin and Telnet connections.
+ *
+ * @cfgcmd{cli-no-pager}
+ * Disable the output pager.
+ *
+ * @cfgcmd{cli-pager-buffer-limit, &lt;nn&gt;}
+ * Limit pager buffer to @c nn lines of output.
+ * A value of @c 0 disables the pager. Default value: @c 100000
+?*/
 VLIB_CONFIG_FUNCTION (unix_config, "unix");
 
 static clib_error_t *
 VLIB_CONFIG_FUNCTION (unix_config, "unix");
 
 static clib_error_t *